C18H17ClFNO4S — CID 2339639
(4-fluorophenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 2339639) has the molecular formula C18H17ClFNO4S and a molecular weight of 397.86 g/mol. Its IUPAC name is (4-fluorophenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (4-fluorophenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2339639 |
| Molecular Formula | C18H17ClFNO4S |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | (4-fluorophenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(Oc1ccc(F)cc1)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C18H17ClFNO4S/c19-17-9-8-15(26(23,24)21-10-2-1-3-11-21)12-16(17)18(22)25-14-6-4-13(20)5-7-14/h4-9,12H,1-3,10-11H2 |
| InChIKey | QNUGOQJNVTZVLI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|