C21H24ClNO4S — CID 16546311
(2,3,6-trimethylphenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 16546311) has the molecular formula C21H24ClNO4S and a molecular weight of 421.95 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2,3,6-trimethylphenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16546311 |
| Molecular Formula | C21H24ClNO4S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (2,3,6-trimethylphenyl) 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C)c(OC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2Cl)c1C |
| InChI | InChI=1S/C21H24ClNO4S/c1-14-7-8-15(2)20(16(14)3)27-21(24)18-13-17(9-10-19(18)22)28(25,26)23-11-5-4-6-12-23/h7-10,13H,4-6,11-12H2,1-3H3 |
| InChIKey | RYYSZDUVJJBLFZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|