C15H12Cl2O4S — CID 86975445
(2,6-dichlorophenyl) 2-methyl-5-methylsulfonylbenzoate (PubChem CID 86975445) has the molecular formula C15H12Cl2O4S and a molecular weight of 359.23 g/mol. Its IUPAC name is (2,6-dichlorophenyl) 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | (2,6-dichlorophenyl) 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 86975445 |
| Molecular Formula | C15H12Cl2O4S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | (2,6-dichlorophenyl) 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H12Cl2O4S/c1-9-6-7-10(22(2,19)20)8-11(9)15(18)21-14-12(16)4-3-5-13(14)17/h3-8H,1-2H3 |
| InChIKey | OTSHQRVDCWXMDD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|