C22H20ClNO4S — CID 2370556
naphthalen-1-yl 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 2370556) has the molecular formula C22H20ClNO4S and a molecular weight of 429.93 g/mol. Its IUPAC name is naphthalen-1-yl 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | naphthalen-1-yl 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2370556 |
| Molecular Formula | C22H20ClNO4S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | naphthalen-1-yl 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(Oc1cccc2ccccc12)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C22H20ClNO4S/c23-20-12-11-17(29(26,27)24-13-4-1-5-14-24)15-19(20)22(25)28-21-10-6-8-16-7-2-3-9-18(16)21/h2-3,6-12,15H,1,4-5,13-14H2 |
| InChIKey | PCHMUFCWEXMIDG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|