C19H18Cl3NO4S — CID 4309442
(2,4-dichlorophenyl)methyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 4309442) has the molecular formula C19H18Cl3NO4S and a molecular weight of 462.78 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2,4-dichlorophenyl)methyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4309442 |
| Molecular Formula | C19H18Cl3NO4S |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccc(Cl)cc1Cl)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C19H18Cl3NO4S/c20-14-5-4-13(18(22)10-14)12-27-19(24)16-11-15(6-7-17(16)21)28(25,26)23-8-2-1-3-9-23/h4-7,10-11H,1-3,8-9,12H2 |
| InChIKey | CXFDAMXOPYGLBW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |