C18H24ClN3O6S — CID 2599121
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 2599121) has the molecular formula C18H24ClN3O6S and a molecular weight of 445.93 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2599121 |
| Molecular Formula | C18H24ClN3O6S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C18H24ClN3O6S/c1-12(2)20-18(25)21-16(23)11-28-17(24)14-10-13(6-7-15(14)19)29(26,27)22-8-4-3-5-9-22/h6-7,10,12H,3-5,8-9,11H2,1-2H3,(H2,20,21,23,25) |
| InChIKey | RRCJQGMHOYBHFU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |