C16H18ClN3O5S — CID 7902125
[2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 7902125) has the molecular formula C16H18ClN3O5S and a molecular weight of 399.86 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7902125 |
| Molecular Formula | C16H18ClN3O5S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | N#CCCNC(=O)COC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C16H18ClN3O5S/c17-14-5-4-12(26(23,24)20-8-1-2-9-20)10-13(14)16(22)25-11-15(21)19-7-3-6-18/h4-5,10H,1-3,7-9,11H2,(H,19,21) |
| InChIKey | ZBEYJUGDALEIPU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|