C20H22Cl2N4O4S — CID 19294087
[(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 19294087) has the molecular formula C20H22Cl2N4O4S and a molecular weight of 485.39 g/mol. Its IUPAC name is [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 19294087 |
| Molecular Formula | C20H22Cl2N4O4S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1c(N)cccc1/C(N)=N/OC(=O)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N4O4S/c1-12-13(6-5-7-17(12)23)19(24)25-30-20(27)14-10-18(16(22)11-15(14)21)31(28,29)26-8-3-2-4-9-26/h5-7,10-11H,2-4,8-9,23H2,1H3,(H2,24,25) |
| InChIKey | WXQFUCXNZZWHOU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|