C17H20Cl2N2O3 — CID 51326639
[1-(2,4-dichlorobenzoyl)piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 51326639) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is [1-(2,4-dichlorobenzoyl)piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(2,4-dichlorobenzoyl)piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 51326639 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [1-(2,4-dichlorobenzoyl)piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCCC(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C17H20Cl2N2O3/c18-13-3-4-14(15(19)10-13)17(23)21-5-1-2-12(11-21)16(22)20-6-8-24-9-7-20/h3-4,10,12H,1-2,5-9,11H2 |
| InChIKey | KUGXYKORNYLMMB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |