C17H15ClN4O2 — CID 98471029
(2R)-2-[1-(2-chlorophenyl)pyrazole-4-carbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile (PubChem CID 98471029) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is (2R)-2-[1-(2-chlorophenyl)pyrazole-4-carbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile.
| Compound Name | (2R)-2-[1-(2-chlorophenyl)pyrazole-4-carbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 98471029 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2R)-2-[1-(2-chlorophenyl)pyrazole-4-carbonyl]-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
| SMILES | N#C[C@H](C(=O)c1cnn(-c2ccccc2Cl)c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C17H15ClN4O2/c18-14-5-1-2-6-15(14)22-11-12(10-20-22)16(23)13(9-19)17(24)21-7-3-4-8-21/h1-2,5-6,10-11,13H,3-4,7-8H2/t13-/m1/s1 |
| InChIKey | QZOFPVLWMTUZPU-CYBMUJFWSA-N |
| XLogP | 2.47 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|