C17H17FN4O2 — CID 48906977
2-cyano-N,N-diethyl-3-[1-(2-fluorophenyl)pyrazol-4-yl]-3-oxopropanamide (PubChem CID 48906977) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-cyano-N,N-diethyl-3-[1-(2-fluorophenyl)pyrazol-4-yl]-3-oxopropanamide.
| Compound Name | 2-cyano-N,N-diethyl-3-[1-(2-fluorophenyl)pyrazol-4-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 48906977 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-cyano-N,N-diethyl-3-[1-(2-fluorophenyl)pyrazol-4-yl]-3-oxopropanamide |
| SMILES | CCN(CC)C(=O)C(C#N)C(=O)c1cnn(-c2ccccc2F)c1 |
| InChI | InChI=1S/C17H17FN4O2/c1-3-21(4-2)17(24)13(9-19)16(23)12-10-20-22(11-12)15-8-6-5-7-14(15)18/h5-8,10-11,13H,3-4H2,1-2H3 |
| InChIKey | PVIDCAYBEDZBRK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|