C18H22N2O2 — CID 98449653
(2R)-2-(4-tert-butylbenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile (PubChem CID 98449653) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2R)-2-(4-tert-butylbenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile.
| Compound Name | (2R)-2-(4-tert-butylbenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 98449653 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2R)-2-(4-tert-butylbenzoyl)-3-oxo-3-pyrrolidin-1-ylpropanenitrile |
| SMILES | CC(C)(C)c1ccc(C(=O)[C@@H](C#N)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H22N2O2/c1-18(2,3)14-8-6-13(7-9-14)16(21)15(12-19)17(22)20-10-4-5-11-20/h6-9,15H,4-5,10-11H2,1-3H3/t15-/m1/s1 |
| InChIKey | DDBLHZVSIICQKZ-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|