C10H10Cl2O4 — CID 141279955
1-(2,4-dichlorophenyl)-2,4,4-trihydroxybutan-1-one (PubChem CID 141279955) has the molecular formula C10H10Cl2O4 and a molecular weight of 265.09 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2,4,4-trihydroxybutan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2,4,4-trihydroxybutan-1-one |
|---|---|
| PubChem CID | 141279955 |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2,4,4-trihydroxybutan-1-one |
| SMILES | O=C(c1ccc(Cl)cc1Cl)C(O)CC(O)O |
| InChI | InChI=1S/C10H10Cl2O4/c11-5-1-2-6(7(12)3-5)10(16)8(13)4-9(14)15/h1-3,8-9,13-15H,4H2 |
| InChIKey | PGYWWBGNEQTFBZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|