C15H11BrCl2N2O — CID 23737069
3-[4-bromo-5-(dimethylamino)furan-2-yl]-2-(2,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 23737069) has the molecular formula C15H11BrCl2N2O and a molecular weight of 386.08 g/mol. Its IUPAC name is 3-[4-bromo-5-(dimethylamino)furan-2-yl]-2-(2,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | 3-[4-bromo-5-(dimethylamino)furan-2-yl]-2-(2,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 23737069 |
| Molecular Formula | C15H11BrCl2N2O |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 3-[4-bromo-5-(dimethylamino)furan-2-yl]-2-(2,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | CN(C)c1oc(C=C(C#N)c2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C15H11BrCl2N2O/c1-20(2)15-13(16)7-11(21-15)5-9(8-19)12-4-3-10(17)6-14(12)18/h3-7H,1-2H3 |
| InChIKey | SGJNCNSYSZJUIQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 40.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|