C21H17BrCl2N2O3 — CID 4645544
3-[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-(2,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 4645544) has the molecular formula C21H17BrCl2N2O3 and a molecular weight of 496.19 g/mol. Its IUPAC name is 3-[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-(2,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | 3-[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-(2,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4645544 |
| Molecular Formula | C21H17BrCl2N2O3 |
| Molecular Weight | 496.19 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 3-[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-(2,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(OCC(=O)N2CCOCC2)c(Br)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17BrCl2N2O3/c22-18-10-14(9-15(12-25)17-3-2-16(23)11-19(17)24)1-4-20(18)29-13-21(27)26-5-7-28-8-6-26/h1-4,9-11H,5-8,13H2 |
| InChIKey | RETVRGYBQTZEPT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.19 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|