C12H9Cl2NOS2 — CID 22365127
2-(2,4-dichlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enenitrile (PubChem CID 22365127) has the molecular formula C12H9Cl2NOS2 and a molecular weight of 318.25 g/mol. Its IUPAC name is 2-(2,4-dichlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enenitrile.
| Compound Name | 2-(2,4-dichlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 22365127 |
| Molecular Formula | C12H9Cl2NOS2 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 2-(2,4-dichlorobenzoyl)-3,3-bis(methylsulfanyl)prop-2-enenitrile |
| SMILES | CSC(SC)=C(C#N)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2NOS2/c1-17-12(18-2)9(6-15)11(16)8-4-3-7(13)5-10(8)14/h3-5H,1-2H3 |
| InChIKey | CSFJOTBHGRNHMI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|