C16H8Cl2N2O3 — CID 21204807
(E)-2-(2,4-dichlorobenzoyl)-3-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 21204807) has the molecular formula C16H8Cl2N2O3 and a molecular weight of 347.16 g/mol. Its IUPAC name is (E)-2-(2,4-dichlorobenzoyl)-3-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,4-dichlorobenzoyl)-3-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21204807 |
| Molecular Formula | C16H8Cl2N2O3 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | (E)-2-(2,4-dichlorobenzoyl)-3-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc([N+](=O)[O-])cc1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H8Cl2N2O3/c17-12-3-6-14(15(18)8-12)16(21)11(9-19)7-10-1-4-13(5-2-10)20(22)23/h1-8H/b11-7+ |
| InChIKey | HVCVKTBIWCIHHH-YRNVUSSQSA-N |
| XLogP | 4.69 |
| TPSA | 84.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|