C13H10Cl2N4O — CID 5402683
N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]pyrazine-2-carboxamide (PubChem CID 5402683) has the molecular formula C13H10Cl2N4O and a molecular weight of 309.16 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]pyrazine-2-carboxamide.
| Compound Name | N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 5402683 |
| Molecular Formula | C13H10Cl2N4O |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-[(E)-1-(2,4-dichlorophenyl)ethylideneamino]pyrazine-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cnccn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl2N4O/c1-8(10-3-2-9(14)6-11(10)15)18-19-13(20)12-7-16-4-5-17-12/h2-7H,1H3,(H,19,20)/b18-8+ |
| InChIKey | SXOBWPRWSZVWGQ-QGMBQPNBSA-N |
| XLogP | 2.94 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|