C14H11Cl3FN3O — CID 135758735
2-[(E)-C-ethyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]-4-fluorophenol (PubChem CID 135758735) has the molecular formula C14H11Cl3FN3O and a molecular weight of 362.62 g/mol. Its IUPAC name is 2-[(E)-C-ethyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]-4-fluorophenol.
| Compound Name | 2-[(E)-C-ethyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]-4-fluorophenol |
|---|---|
| PubChem CID | 135758735 |
| Molecular Formula | C14H11Cl3FN3O |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 2-[(E)-C-ethyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]-4-fluorophenol |
| SMILES | CC/C(=N\Nc1nc(Cl)c(Cl)cc1Cl)c1cc(F)ccc1O |
| InChI | InChI=1S/C14H11Cl3FN3O/c1-2-11(8-5-7(18)3-4-12(8)22)20-21-14-10(16)6-9(15)13(17)19-14/h3-6,22H,2H2,1H3,(H,19,21)/b20-11+ |
| InChIKey | RTSHZHHWLURYMH-RGVLZGJSSA-N |
| XLogP | 5.11 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|