C9H10ClFN4 — CID 140813804
2-[1-(4-chloro-2-fluorophenyl)ethylideneamino]guanidine (PubChem CID 140813804) has the molecular formula C9H10ClFN4 and a molecular weight of 228.66 g/mol. Its IUPAC name is 2-[1-(4-chloro-2-fluorophenyl)ethylideneamino]guanidine.
| Compound Name | 2-[1-(4-chloro-2-fluorophenyl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 140813804 |
| Molecular Formula | C9H10ClFN4 |
| Molecular Weight | 228.66 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-[1-(4-chloro-2-fluorophenyl)ethylideneamino]guanidine |
| SMILES | CC(=NN=C(N)N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C9H10ClFN4/c1-5(14-15-9(12)13)7-3-2-6(10)4-8(7)11/h2-4H,1H3,(H4,12,13,15) |
| InChIKey | XQDFHRQPADSZAX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.66 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|