C12H20ClN9 — CID 45261943
2-[(E)-1-[2-amino-3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride (PubChem CID 45261943) has the molecular formula C12H20ClN9 and a molecular weight of 325.81 g/mol. Its IUPAC name is 2-[(E)-1-[2-amino-3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-1-[2-amino-3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 45261943 |
| Molecular Formula | C12H20ClN9 |
| Molecular Weight | 325.81 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[(E)-1-[2-amino-3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride |
| SMILES | C/C(=N\N=C(N)N)c1cccc(/C(C)=N/N=C(N)N)c1N.Cl |
| InChI | InChI=1S/C12H19N9.ClH/c1-6(18-20-11(14)15)8-4-3-5-9(10(8)13)7(2)19-21-12(16)17;/h3-5H,13H2,1-2H3,(H4,14,15,20)(H4,16,17,21);1H/b18-6+,19-7+; |
| InChIKey | OZMGMPRGROBAGH-PFUGLILTSA-N |
| XLogP | -0.31 |
| TPSA | 179.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.81 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|