C10H12N4O2 — CID 135604801
2-[(E)-1-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)ethylideneamino]guanidine (PubChem CID 135604801) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[(E)-1-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 135604801 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(E)-1-(2-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1ccccc(=O)c1O |
| InChI | InChI=1S/C10H12N4O2/c1-6(13-14-10(11)12)7-4-2-3-5-8(15)9(7)16/h2-5H,1H3,(H,15,16)(H4,11,12,14)/b13-6+ |
| InChIKey | JJZNSVJMDTUWPY-AWNIVKPZSA-N |
| XLogP | -0.25 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|