C7H13ClN6 — CID 137202782
2-[1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine;hydrochloride (PubChem CID 137202782) has the molecular formula C7H13ClN6 and a molecular weight of 216.68 g/mol. Its IUPAC name is 2-[1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 137202782 |
| Molecular Formula | C7H13ClN6 |
| Molecular Weight | 216.68 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-[1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine;hydrochloride |
| SMILES | CC(=NN=C(N)N)c1cn[nH]c1C.Cl |
| InChI | InChI=1S/C7H12N6.ClH/c1-4-6(3-10-11-4)5(2)12-13-7(8)9;/h3H,1-2H3,(H,10,11)(H4,8,9,13);1H |
| InChIKey | JKESYHWVIINESO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.68 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|