C7H11N5O2 — CID 77042461
N-(2-amino-2-hydroxyiminoethyl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 77042461) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 77042461 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)NCC(N)=NO |
| InChI | InChI=1S/C7H11N5O2/c1-4-5(2-10-11-4)7(13)9-3-6(8)12-14/h2,14H,3H2,1H3,(H2,8,12)(H,9,13)(H,10,11) |
| InChIKey | ORKVVKBOIGCVRC-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|