C7H9N7O — CID 63934294
5-methyl-N-(2H-tetrazol-5-ylmethyl)-1H-pyrazole-4-carboxamide (PubChem CID 63934294) has the molecular formula C7H9N7O and a molecular weight of 207.20 g/mol. Its IUPAC name is 5-methyl-N-(2H-tetrazol-5-ylmethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-(2H-tetrazol-5-ylmethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63934294 |
| Molecular Formula | C7H9N7O |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 5-methyl-N-(2H-tetrazol-5-ylmethyl)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C7H9N7O/c1-4-5(2-9-10-4)7(15)8-3-6-11-13-14-12-6/h2H,3H2,1H3,(H,8,15)(H,9,10)(H,11,12,13,14) |
| InChIKey | YWHJVMZILHPDJA-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |