C7H12N6 — CID 135573632
2-[(E)-1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine (PubChem CID 135573632) has the molecular formula C7H12N6 and a molecular weight of 180.22 g/mol. Its IUPAC name is 2-[(E)-1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 135573632 |
| Molecular Formula | C7H12N6 |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 2-[(E)-1-(5-methyl-1H-pyrazol-4-yl)ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1cn[nH]c1C |
| InChI | InChI=1S/C7H12N6/c1-4-6(3-10-11-4)5(2)12-13-7(8)9/h3H,1-2H3,(H,10,11)(H4,8,9,13)/b12-5+ |
| InChIKey | ZUCUGLJWCLRUAB-LFYBBSHMSA-N |
| XLogP | -0.28 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|