C12H16F3N3 — CID 61361101
N-amino-N'-tert-butyl-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 61361101) has the molecular formula C12H16F3N3 and a molecular weight of 259.28 g/mol. Its IUPAC name is N-amino-N'-tert-butyl-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N-amino-N'-tert-butyl-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 61361101 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-amino-N'-tert-butyl-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | CC(C)(C)/N=C(\NN)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3N3/c1-11(2,3)17-10(18-16)8-4-6-9(7-5-8)12(13,14)15/h4-7H,16H2,1-3H3,(H,17,18) |
| InChIKey | WTDBIYGYSONUOO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|