C23H19F6N — CID 101437889
N-tert-butyl-2,5-bis[4-(trifluoromethyl)phenyl]pent-1-en-4-yn-3-imine (PubChem CID 101437889) has the molecular formula C23H19F6N and a molecular weight of 423.40 g/mol. Its IUPAC name is N-tert-butyl-2,5-bis[4-(trifluoromethyl)phenyl]pent-1-en-4-yn-3-imine.
| Compound Name | N-tert-butyl-2,5-bis[4-(trifluoromethyl)phenyl]pent-1-en-4-yn-3-imine |
|---|---|
| PubChem CID | 101437889 |
| Molecular Formula | C23H19F6N |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-tert-butyl-2,5-bis[4-(trifluoromethyl)phenyl]pent-1-en-4-yn-3-imine |
| SMILES | C=C(/C(C#Cc1ccc(C(F)(F)F)cc1)=N/C(C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F6N/c1-15(17-8-12-19(13-9-17)23(27,28)29)20(30-21(2,3)4)14-7-16-5-10-18(11-6-16)22(24,25)26/h5-6,8-13H,1H2,2-4H3/b30-20+ |
| InChIKey | XCSZDTUWEXJPJT-TWKHWXDSSA-N |
| XLogP | 7.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|