C12H16F2N2O — CID 172751333
4-(1,1-difluoropentyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 172751333) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-(1,1-difluoropentyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(1,1-difluoropentyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 172751333 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-(1,1-difluoropentyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCCC(F)(F)c1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C12H16F2N2O/c1-2-3-8-12(13,14)10-6-4-9(5-7-10)11(15)16-17/h4-7,17H,2-3,8H2,1H3,(H2,15,16) |
| InChIKey | KKKJJQYRNLHUKA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|