C10H11F3N2O — CID 159992522
N'-hydroxy-4-(3,3,3-trifluoropropyl)benzenecarboximidamide (PubChem CID 159992522) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is N'-hydroxy-4-(3,3,3-trifluoropropyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-(3,3,3-trifluoropropyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 159992522 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N'-hydroxy-4-(3,3,3-trifluoropropyl)benzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O/c11-10(12,13)6-5-7-1-3-8(4-2-7)9(14)15-16/h1-4,16H,5-6H2,(H2,14,15) |
| InChIKey | OHCZJSVRZOSLFF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|