C11H14F2N2O — CID 156800040
4-(1,1-difluorobutyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 156800040) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-(1,1-difluorobutyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(1,1-difluorobutyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 156800040 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-(1,1-difluorobutyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CCCC(F)(F)c1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C11H14F2N2O/c1-2-7-11(12,13)9-5-3-8(4-6-9)10(14)15-16/h3-6,16H,2,7H2,1H3,(H2,14,15) |
| InChIKey | SPURGXZVPKYWDP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|