C14H15Br2F3 — CID 101198648
1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene (PubChem CID 101198648) has the molecular formula C14H15Br2F3 and a molecular weight of 400.08 g/mol. Its IUPAC name is 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 101198648 |
| Molecular Formula | C14H15Br2F3 |
| Molecular Weight | 400.08 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene |
| SMILES | CCCCC/C(Br)=C(\Br)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15Br2F3/c1-2-3-4-5-12(15)13(16)10-6-8-11(9-7-10)14(17,18)19/h6-9H,2-5H2,1H3/b13-12+ |
| InChIKey | XSOXDHMODFHMKI-OUKQBFOZSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.08 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|