About 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene
1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene (PubChem CID 101198648) has the molecular formula C14H15Br2F3
and a molecular weight of 400.08 g/mol. Its IUPAC name is 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene |
| PubChem CID | 101198648 |
| Molecular Formula | C14H15Br2F3 |
| Molecular Weight | 400.08 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene |
| SMILES | CCCCC/C(Br)=C(\Br)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15Br2F3/c1-2-3-4-5-12(15)13(16)10-6-8-11(9-7-10)14(17,18)19/h6-9H,2-5H2,1H3/b13-12+ |
| InChIKey | XSOXDHMODFHMKI-OUKQBFOZSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.08 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene?
The IUPAC name of 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene (CID 101198648) is 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene.
What is the SMILES notation for 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene?
The canonical SMILES for 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene is CCCCC/C(Br)=C(\Br)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene?
The InChIKey is XSOXDHMODFHMKI-OUKQBFOZSA-N. The full InChI is InChI=1S/C14H15Br2F3/c1-2-3-4-5-12(15)13(16)10-6-8-11(9-7-10)14(17,18)19/h6-9H,2-5H2,1H3/b13-12+.
What are the key properties of 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene?
1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene has a molecular weight of 400.08 g/mol, XLogP of 6.74, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1,2-dibromohept-1-enyl]-4-(trifluoromethyl)benzene is sourced from PubChem (CID 101198648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).