C12H9Br2F3O2 — CID 54144529
ethyl 2,3-dibromo-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 54144529) has the molecular formula C12H9Br2F3O2 and a molecular weight of 402.00 g/mol. Its IUPAC name is ethyl 2,3-dibromo-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl 2,3-dibromo-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54144529 |
| Molecular Formula | C12H9Br2F3O2 |
| Molecular Weight | 402.00 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | ethyl 2,3-dibromo-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(Br)=C(Br)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9Br2F3O2/c1-2-19-11(18)10(14)9(13)7-3-5-8(6-4-7)12(15,16)17/h3-6H,2H2,1H3 |
| InChIKey | ODKQLGYPLRQWCJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|