C14H9F6NO2 — CID 140766671
ethyl 2-cyano-4,4,4-trifluoro-3-[4-(trifluoromethyl)phenyl]but-2-enoate (PubChem CID 140766671) has the molecular formula C14H9F6NO2 and a molecular weight of 337.22 g/mol. Its IUPAC name is ethyl 2-cyano-4,4,4-trifluoro-3-[4-(trifluoromethyl)phenyl]but-2-enoate.
| Compound Name | ethyl 2-cyano-4,4,4-trifluoro-3-[4-(trifluoromethyl)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 140766671 |
| Molecular Formula | C14H9F6NO2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | ethyl 2-cyano-4,4,4-trifluoro-3-[4-(trifluoromethyl)phenyl]but-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(c1ccc(C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H9F6NO2/c1-2-23-12(22)10(7-21)11(14(18,19)20)8-3-5-9(6-4-8)13(15,16)17/h3-6H,2H2,1H3 |
| InChIKey | UMSYKYCULXCMAD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|