C19H14ClFN2O3 — CID 91331196
ethyl 3-[(4-chlorobenzoyl)amino]-2-cyano-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 91331196) has the molecular formula C19H14ClFN2O3 and a molecular weight of 372.78 g/mol. Its IUPAC name is ethyl 3-[(4-chlorobenzoyl)amino]-2-cyano-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | ethyl 3-[(4-chlorobenzoyl)amino]-2-cyano-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91331196 |
| Molecular Formula | C19H14ClFN2O3 |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | ethyl 3-[(4-chlorobenzoyl)amino]-2-cyano-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(NC(=O)c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14ClFN2O3/c1-2-26-19(25)16(11-22)17(12-5-9-15(21)10-6-12)23-18(24)13-3-7-14(20)8-4-13/h3-10H,2H2,1H3,(H,23,24) |
| InChIKey | JWTRXIGPJUUHLG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|