C18H15ClFN3O5 — CID 46497116
ethyl (Z)-3-(3-chloro-4-fluoroanilino)-2-[(4-nitrobenzoyl)amino]prop-2-enoate (PubChem CID 46497116) has the molecular formula C18H15ClFN3O5 and a molecular weight of 407.79 g/mol. Its IUPAC name is ethyl (Z)-3-(3-chloro-4-fluoroanilino)-2-[(4-nitrobenzoyl)amino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(3-chloro-4-fluoroanilino)-2-[(4-nitrobenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 46497116 |
| Molecular Formula | C18H15ClFN3O5 |
| Molecular Weight | 407.79 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | ethyl (Z)-3-(3-chloro-4-fluoroanilino)-2-[(4-nitrobenzoyl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/Nc1ccc(F)c(Cl)c1)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15ClFN3O5/c1-2-28-18(25)16(10-21-12-5-8-15(20)14(19)9-12)22-17(24)11-3-6-13(7-4-11)23(26)27/h3-10,21H,2H2,1H3,(H,22,24)/b16-10- |
| InChIKey | LWUYDUVALWNOHV-YBEGLDIGSA-N |
| XLogP | 3.63 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|