C20H13Cl2NO2 — CID 24850816
ethyl (E)-3,5-bis(4-chlorophenyl)-2-cyanopent-2-en-4-ynoate (PubChem CID 24850816) has the molecular formula C20H13Cl2NO2 and a molecular weight of 370.24 g/mol. Its IUPAC name is ethyl (E)-3,5-bis(4-chlorophenyl)-2-cyanopent-2-en-4-ynoate.
| Compound Name | ethyl (E)-3,5-bis(4-chlorophenyl)-2-cyanopent-2-en-4-ynoate |
|---|---|
| PubChem CID | 24850816 |
| Molecular Formula | C20H13Cl2NO2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | ethyl (E)-3,5-bis(4-chlorophenyl)-2-cyanopent-2-en-4-ynoate |
| SMILES | CCOC(=O)/C(C#N)=C(/C#Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H13Cl2NO2/c1-2-25-20(24)19(13-23)18(15-6-10-17(22)11-7-15)12-5-14-3-8-16(21)9-4-14/h3-4,6-11H,2H2,1H3/b19-18- |
| InChIKey | LLYUYSHTCLUHDK-HNENSFHCSA-N |
| XLogP | 4.89 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|