C15H11ClN2O4 — CID 164665336
ethyl 7-(4-chlorophenyl)-2-diazo-3,5-dioxohept-6-ynoate (PubChem CID 164665336) has the molecular formula C15H11ClN2O4 and a molecular weight of 318.72 g/mol. Its IUPAC name is ethyl 7-(4-chlorophenyl)-2-diazo-3,5-dioxohept-6-ynoate.
| Compound Name | ethyl 7-(4-chlorophenyl)-2-diazo-3,5-dioxohept-6-ynoate |
|---|---|
| PubChem CID | 164665336 |
| Molecular Formula | C15H11ClN2O4 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | ethyl 7-(4-chlorophenyl)-2-diazo-3,5-dioxohept-6-ynoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)CC(=O)C#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClN2O4/c1-2-22-15(21)14(18-17)13(20)9-12(19)8-5-10-3-6-11(16)7-4-10/h3-4,6-7H,2,9H2,1H3 |
| InChIKey | ZDNYRJBIBSFIPO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|