C22H20N2O4S — CID 164665473
1-diazo-1-(4-methylphenyl)sulfonyl-6-(4-propylphenyl)hex-5-yne-2,4-dione (PubChem CID 164665473) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-diazo-1-(4-methylphenyl)sulfonyl-6-(4-propylphenyl)hex-5-yne-2,4-dione.
| Compound Name | 1-diazo-1-(4-methylphenyl)sulfonyl-6-(4-propylphenyl)hex-5-yne-2,4-dione |
|---|---|
| PubChem CID | 164665473 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-diazo-1-(4-methylphenyl)sulfonyl-6-(4-propylphenyl)hex-5-yne-2,4-dione |
| SMILES | CCCc1ccc(C#CC(=O)CC(=O)C(=[N+]=[N-])S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O4S/c1-3-4-17-7-9-18(10-8-17)11-12-19(25)15-21(26)22(24-23)29(27,28)20-13-5-16(2)6-14-20/h5-10,13-14H,3-4,15H2,1-2H3 |
| InChIKey | ZMZFALILKSYMLL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|