C28H22F2 — CID 86748682
1-[(E)-1,2-difluoro-4-(4-propylphenyl)but-1-en-3-ynyl]-4-[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 86748682) has the molecular formula C28H22F2 and a molecular weight of 396.48 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoro-4-(4-propylphenyl)but-1-en-3-ynyl]-4-[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 1-[(E)-1,2-difluoro-4-(4-propylphenyl)but-1-en-3-ynyl]-4-[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 86748682 |
| Molecular Formula | C28H22F2 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[(E)-1,2-difluoro-4-(4-propylphenyl)but-1-en-3-ynyl]-4-[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | CCCc1ccc(C#C/C(F)=C(\F)c2ccc(C#Cc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H22F2/c1-3-4-22-9-11-24(12-10-22)17-20-27(29)28(30)26-18-15-25(16-19-26)14-13-23-7-5-21(2)6-8-23/h5-12,15-16,18-19H,3-4H2,1-2H3/b28-27+ |
| InChIKey | PMCVTARBCAQRGS-BYYHNAKLSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|