C23H22O — CID 164665534
1,5-bis(4-propylphenyl)penta-1,4-diyn-3-one (PubChem CID 164665534) has the molecular formula C23H22O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1,5-bis(4-propylphenyl)penta-1,4-diyn-3-one.
| Compound Name | 1,5-bis(4-propylphenyl)penta-1,4-diyn-3-one |
|---|---|
| PubChem CID | 164665534 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1,5-bis(4-propylphenyl)penta-1,4-diyn-3-one |
| SMILES | CCCc1ccc(C#CC(=O)C#Cc2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C23H22O/c1-3-5-19-7-11-21(12-8-19)15-17-23(24)18-16-22-13-9-20(6-4-2)10-14-22/h7-14H,3-6H2,1-2H3 |
| InChIKey | UYQWWFYLBRPOHY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|