C31H32F2 — CID 122420807
1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(4-propylphenyl)ethenyl]-2-ethylbenzene (PubChem CID 122420807) has the molecular formula C31H32F2 and a molecular weight of 442.59 g/mol. Its IUPAC name is 1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(4-propylphenyl)ethenyl]-2-ethylbenzene.
| Compound Name | 1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(4-propylphenyl)ethenyl]-2-ethylbenzene |
|---|---|
| PubChem CID | 122420807 |
| Molecular Formula | C31H32F2 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 1-[2-(4-butylphenyl)ethynyl]-4-[(E)-1,2-difluoro-2-(4-propylphenyl)ethenyl]-2-ethylbenzene |
| SMILES | CCCCc1ccc(C#Cc2ccc(/C(F)=C(\F)c3ccc(CCC)cc3)cc2CC)cc1 |
| InChI | InChI=1S/C31H32F2/c1-4-7-9-24-10-12-25(13-11-24)14-17-27-20-21-29(22-26(27)6-3)31(33)30(32)28-18-15-23(8-5-2)16-19-28/h10-13,15-16,18-22H,4-9H2,1-3H3/b31-30+ |
| InChIKey | UFZURXREKJMUNV-NVQSTNCTSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|