C22H18F6O2 — CID 91481403
ethyl 4-methyl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoate (PubChem CID 91481403) has the molecular formula C22H18F6O2 and a molecular weight of 428.37 g/mol. Its IUPAC name is ethyl 4-methyl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoate.
| Compound Name | ethyl 4-methyl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 91481403 |
| Molecular Formula | C22H18F6O2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | ethyl 4-methyl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC(C)=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F6O2/c1-3-30-19(29)13-4-14(2)20(15-5-9-17(10-6-15)21(23,24)25)16-7-11-18(12-8-16)22(26,27)28/h4-13H,3H2,1-2H3 |
| InChIKey | DDUDXVHRRUONMJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|