C21H21F3O4S — CID 140993502
ethyl 2-[(4-methylsulfonylphenyl)-[4-(trifluoromethyl)phenyl]methylidene]butanoate (PubChem CID 140993502) has the molecular formula C21H21F3O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is ethyl 2-[(4-methylsulfonylphenyl)-[4-(trifluoromethyl)phenyl]methylidene]butanoate.
| Compound Name | ethyl 2-[(4-methylsulfonylphenyl)-[4-(trifluoromethyl)phenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 140993502 |
| Molecular Formula | C21H21F3O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | ethyl 2-[(4-methylsulfonylphenyl)-[4-(trifluoromethyl)phenyl]methylidene]butanoate |
| SMILES | CCOC(=O)C(CC)=C(c1ccc(C(F)(F)F)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H21F3O4S/c1-4-18(20(25)28-5-2)19(14-6-10-16(11-7-14)21(22,23)24)15-8-12-17(13-9-15)29(3,26)27/h6-13H,4-5H2,1-3H3 |
| InChIKey | SMLSOEFDDBQKEW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|