C21H21FO6S — CID 21262957
(Z)-3-ethoxycarbonyl-4-(3-fluoro-4-methylphenyl)-4-(4-methylsulfonylphenyl)but-3-enoic acid (PubChem CID 21262957) has the molecular formula C21H21FO6S and a molecular weight of 420.46 g/mol. Its IUPAC name is (Z)-3-ethoxycarbonyl-4-(3-fluoro-4-methylphenyl)-4-(4-methylsulfonylphenyl)but-3-enoic acid.
| Compound Name | (Z)-3-ethoxycarbonyl-4-(3-fluoro-4-methylphenyl)-4-(4-methylsulfonylphenyl)but-3-enoic acid |
|---|---|
| PubChem CID | 21262957 |
| Molecular Formula | C21H21FO6S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (Z)-3-ethoxycarbonyl-4-(3-fluoro-4-methylphenyl)-4-(4-methylsulfonylphenyl)but-3-enoic acid |
| SMILES | CCOC(=O)/C(CC(=O)O)=C(/c1ccc(S(C)(=O)=O)cc1)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C21H21FO6S/c1-4-28-21(25)17(12-19(23)24)20(15-6-5-13(2)18(22)11-15)14-7-9-16(10-8-14)29(3,26)27/h5-11H,4,12H2,1-3H3,(H,23,24)/b20-17- |
| InChIKey | HSLGAZPVEIXRFF-JZJYNLBNSA-N |
| XLogP | 3.38 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|