C20H19BrO6S — CID 70223233
(E)-4-(4-bromophenyl)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)but-3-enoic acid (PubChem CID 70223233) has the molecular formula C20H19BrO6S and a molecular weight of 467.34 g/mol. Its IUPAC name is (E)-4-(4-bromophenyl)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)but-3-enoic acid.
| Compound Name | (E)-4-(4-bromophenyl)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)but-3-enoic acid |
|---|---|
| PubChem CID | 70223233 |
| Molecular Formula | C20H19BrO6S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | (E)-4-(4-bromophenyl)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)but-3-enoic acid |
| SMILES | CCOC(=O)/C(CC(=O)O)=C(/c1ccc(Br)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H19BrO6S/c1-3-27-20(24)17(12-18(22)23)19(13-4-8-15(21)9-5-13)14-6-10-16(11-7-14)28(2,25)26/h4-11H,3,12H2,1-2H3,(H,22,23)/b19-17- |
| InChIKey | FCPFFDSMZRDYKK-ZPHPHTNESA-N |
| XLogP | 3.69 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|