C20H20F2O4S — CID 57053959
ethyl 2-[(3,5-difluorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate (PubChem CID 57053959) has the molecular formula C20H20F2O4S and a molecular weight of 394.44 g/mol. Its IUPAC name is ethyl 2-[(3,5-difluorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate.
| Compound Name | ethyl 2-[(3,5-difluorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate |
|---|---|
| PubChem CID | 57053959 |
| Molecular Formula | C20H20F2O4S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl 2-[(3,5-difluorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate |
| SMILES | CCOC(=O)C(CC)=C(c1ccc(S(C)(=O)=O)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H20F2O4S/c1-4-18(20(23)26-5-2)19(14-10-15(21)12-16(22)11-14)13-6-8-17(9-7-13)27(3,24)25/h6-12H,4-5H2,1-3H3 |
| InChIKey | DZRQXLFUJKDBGV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|