C18H17FO5S — CID 54140882
2-[(4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid (PubChem CID 54140882) has the molecular formula C18H17FO5S and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid.
| Compound Name | 2-[(4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 54140882 |
| Molecular Formula | C18H17FO5S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-[(4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=C(CCO)C(=O)O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H17FO5S/c1-25(23,24)15-8-4-13(5-9-15)17(16(10-11-20)18(21)22)12-2-6-14(19)7-3-12/h2-9,20H,10-11H2,1H3,(H,21,22) |
| InChIKey | OAZRPVIYVJLXTF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|