C18H16ClFO5S — CID 70341639
(2E)-2-[(3-chloro-4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid (PubChem CID 70341639) has the molecular formula C18H16ClFO5S and a molecular weight of 398.84 g/mol. Its IUPAC name is (2E)-2-[(3-chloro-4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid.
| Compound Name | (2E)-2-[(3-chloro-4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 70341639 |
| Molecular Formula | C18H16ClFO5S |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (2E)-2-[(3-chloro-4-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoic acid |
| SMILES | CS(=O)(=O)c1ccc(/C(=C(/CCO)C(=O)O)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H16ClFO5S/c1-26(24,25)13-5-2-11(3-6-13)17(14(8-9-21)18(22)23)12-4-7-16(20)15(19)10-12/h2-7,10,21H,8-9H2,1H3,(H,22,23)/b17-14+ |
| InChIKey | SJVUDHYFPRJLHO-SAPNQHFASA-N |
| XLogP | 3.15 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|