C18H19NO5S — CID 67599689
(2Z)-4-hydroxy-2-[(3-methylphenyl)-(4-sulfamoylphenyl)methylidene]butanoic acid (PubChem CID 67599689) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is (2Z)-4-hydroxy-2-[(3-methylphenyl)-(4-sulfamoylphenyl)methylidene]butanoic acid.
| Compound Name | (2Z)-4-hydroxy-2-[(3-methylphenyl)-(4-sulfamoylphenyl)methylidene]butanoic acid |
|---|---|
| PubChem CID | 67599689 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (2Z)-4-hydroxy-2-[(3-methylphenyl)-(4-sulfamoylphenyl)methylidene]butanoic acid |
| SMILES | Cc1cccc(/C(=C(/CCO)C(=O)O)c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H19NO5S/c1-12-3-2-4-14(11-12)17(16(9-10-20)18(21)22)13-5-7-15(8-6-13)25(19,23)24/h2-8,11,20H,9-10H2,1H3,(H,21,22)(H2,19,23,24)/b17-16- |
| InChIKey | VLXCTPNDXJZXQM-MSUUIHNZSA-N |
| XLogP | 1.91 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|